C22H25N5O2 — CID 159898104
7-[4-[3-(3H-isoindol-5-ylamino)propyl]piperazin-1-yl]-3H-1,3-benzoxazol-2-one (PubChem CID 159898104) has the molecular formula C22H25N5O2 and a molecular weight of 391.48 g/mol. Its IUPAC name is 7-[4-[3-(3H-isoindol-5-ylamino)propyl]piperazin-1-yl]-3H-1,3-benzoxazol-2-one.
| Compound Name | 7-[4-[3-(3H-isoindol-5-ylamino)propyl]piperazin-1-yl]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 159898104 |
| Molecular Formula | C22H25N5O2 |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | 7-[4-[3-(3H-isoindol-5-ylamino)propyl]piperazin-1-yl]-3H-1,3-benzoxazol-2-one |
| SMILES | O=c1[nH]c2cccc(N3CCN(CCCNc4ccc5c(c4)CN=C5)CC3)c2o1 |
| InChI | InChI=1S/C22H25N5O2/c28-22-25-19-3-1-4-20(21(19)29-22)27-11-9-26(10-12-27)8-2-7-24-18-6-5-16-14-23-15-17(16)13-18/h1,3-6,13-14,24H,2,7-12,15H2,(H,25,28) |
| InChIKey | REXRFJHAZZJVLY-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 76.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|