C26H48O8 — CID 159910299
bis(2-(2-ethoxyethoxy)ethyl acetate);tricyclo[5.2.1.02,6]decane (PubChem CID 159910299) has the molecular formula C26H48O8 and a molecular weight of 488.66 g/mol. Its IUPAC name is bis(2-(2-ethoxyethoxy)ethyl acetate);tricyclo[5.2.1.02,6]decane.
| Compound Name | bis(2-(2-ethoxyethoxy)ethyl acetate);tricyclo[5.2.1.02,6]decane |
|---|---|
| PubChem CID | 159910299 |
| Molecular Formula | C26H48O8 |
| Molecular Weight | 488.66 g/mol |
| Exact Mass | 488.33 |
| IUPAC Name | bis(2-(2-ethoxyethoxy)ethyl acetate);tricyclo[5.2.1.02,6]decane |
| SMILES | C1CC2C3CCC(C3)C2C1.CCOCCOCCOC(C)=O.CCOCCOCCOC(C)=O |
| InChI | InChI=1S/C10H16.2C8H16O4/c1-2-9-7-4-5-8(6-7)10(9)3-1;2*1-3-10-4-5-11-6-7-12-8(2)9/h7-10H,1-6H2;2*3-7H2,1-2H3 |
| InChIKey | NXCIMCNRYYYBDD-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.66 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|