C13H33NO3S6Si — CID 159916460
N,N-bis(methylsulfanyl)-3-triethoxysilylpropan-1-amine;(methyltetrasulfanyl)methane (PubChem CID 159916460) has the molecular formula C13H33NO3S6Si and a molecular weight of 471.90 g/mol. Its IUPAC name is N,N-bis(methylsulfanyl)-3-triethoxysilylpropan-1-amine;(methyltetrasulfanyl)methane.
| Compound Name | N,N-bis(methylsulfanyl)-3-triethoxysilylpropan-1-amine;(methyltetrasulfanyl)methane |
|---|---|
| PubChem CID | 159916460 |
| Molecular Formula | C13H33NO3S6Si |
| Molecular Weight | 471.90 g/mol |
| Exact Mass | 471.06 |
| IUPAC Name | N,N-bis(methylsulfanyl)-3-triethoxysilylpropan-1-amine;(methyltetrasulfanyl)methane |
| SMILES | CCO[Si](CCCN(SC)SC)(OCC)OCC.CSSSSC |
| InChI | InChI=1S/C11H27NO3S2Si.C2H6S4/c1-6-13-18(14-7-2,15-8-3)11-9-10-12(16-4)17-5;1-3-5-6-4-2/h6-11H2,1-5H3;1-2H3 |
| InChIKey | NXVPQNLTXYWKIZ-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.90 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|