About benzyl formate;4-(2-butylsulfanylphenyl)piperidin-4-ol
benzyl formate;4-(2-butylsulfanylphenyl)piperidin-4-ol (PubChem CID 159922003) has the molecular formula C23H31NO3S
and a molecular weight of 401.57 g/mol. Its IUPAC name is benzyl formate;4-(2-butylsulfanylphenyl)piperidin-4-ol.
Molecular Properties
| Compound Name | benzyl formate;4-(2-butylsulfanylphenyl)piperidin-4-ol |
| PubChem CID | 159922003 |
| Molecular Formula | C23H31NO3S |
| Molecular Weight | 401.57 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | benzyl formate;4-(2-butylsulfanylphenyl)piperidin-4-ol |
| SMILES | CCCCSc1ccccc1C1(O)CCNCC1.O=COCc1ccccc1 |
| InChI | InChI=1S/C15H23NOS.C8H8O2/c1-2-3-12-18-14-7-5-4-6-13(14)15(17)8-10-16-11-9-15;9-7-10-6-8-4-2-1-3-5-8/h4-7,16-17H,2-3,8-12H2,1H3;1-5,7H,6H2 |
| InChIKey | NYNCLLHQGAMMBK-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.57 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze benzyl formate;4-(2-butylsulfanylphenyl)piperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl formate;4-(2-butylsulfanylphenyl)piperidin-4-ol?
The IUPAC name of benzyl formate;4-(2-butylsulfanylphenyl)piperidin-4-ol (CID 159922003) is benzyl formate;4-(2-butylsulfanylphenyl)piperidin-4-ol.
What is the SMILES notation for benzyl formate;4-(2-butylsulfanylphenyl)piperidin-4-ol?
The canonical SMILES for benzyl formate;4-(2-butylsulfanylphenyl)piperidin-4-ol is CCCCSc1ccccc1C1(O)CCNCC1.O=COCc1ccccc1.
What is the InChIKey of benzyl formate;4-(2-butylsulfanylphenyl)piperidin-4-ol?
The InChIKey is NYNCLLHQGAMMBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NOS.C8H8O2/c1-2-3-12-18-14-7-5-4-6-13(14)15(17)8-10-16-11-9-15;9-7-10-6-8-4-2-1-3-5-8/h4-7,16-17H,2-3,8-12H2,1H3;1-5,7H,6H2.
What are the key properties of benzyl formate;4-(2-butylsulfanylphenyl)piperidin-4-ol?
benzyl formate;4-(2-butylsulfanylphenyl)piperidin-4-ol has a molecular weight of 401.57 g/mol, XLogP of 4.51, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl formate;4-(2-butylsulfanylphenyl)piperidin-4-ol is sourced from PubChem (CID 159922003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).