C16H23NO4 — CID 174724586
benzyl formate;2-(3-hydroxypyrrolidin-3-yl)-2-methylpropanal (PubChem CID 174724586) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is benzyl formate;2-(3-hydroxypyrrolidin-3-yl)-2-methylpropanal.
| Compound Name | benzyl formate;2-(3-hydroxypyrrolidin-3-yl)-2-methylpropanal |
|---|---|
| PubChem CID | 174724586 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | benzyl formate;2-(3-hydroxypyrrolidin-3-yl)-2-methylpropanal |
| SMILES | CC(C)(C=O)C1(O)CCNC1.O=COCc1ccccc1 |
| InChI | InChI=1S/C8H15NO2.C8H8O2/c1-7(2,6-10)8(11)3-4-9-5-8;9-7-10-6-8-4-2-1-3-5-8/h6,9,11H,3-5H2,1-2H3;1-5,7H,6H2 |
| InChIKey | ZIGWZSTWSUGCLN-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|