C9H13F3O3RhS — CID 159925918
cycloocta-1,3-diene;rhodium;trifluoromethanesulfonic acid (PubChem CID 159925918) has the molecular formula C9H13F3O3RhS and a molecular weight of 361.17 g/mol. Its IUPAC name is cycloocta-1,3-diene;rhodium;trifluoromethanesulfonic acid.
| Compound Name | cycloocta-1,3-diene;rhodium;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 159925918 |
| Molecular Formula | C9H13F3O3RhS |
| Molecular Weight | 361.17 g/mol |
| Exact Mass | 360.96 |
| IUPAC Name | cycloocta-1,3-diene;rhodium;trifluoromethanesulfonic acid |
| SMILES | C1=CCCCCC=C1.O=S(=O)(O)C(F)(F)F.[Rh] |
| InChI | InChI=1S/C8H12.CHF3O3S.Rh/c1-2-4-6-8-7-5-3-1;2-1(3,4)8(5,6)7;/h1-4H,5-8H2;(H,5,6,7); |
| InChIKey | NYZXIEMPBJRAGT-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.17 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|