C30H22 — CID 159928803
(2'R,10'S,11'S)-spiro[fluorene-9,9'-pentacyclo[9.7.0.02,10.03,8.012,17]octadeca-3,5,7,12,14,16-hexaene] (PubChem CID 159928803) has the molecular formula C30H22 and a molecular weight of 382.51 g/mol. Its IUPAC name is (2'R,10'S,11'S)-spiro[fluorene-9,9'-pentacyclo[9.7.0.02,10.03,8.012,17]octadeca-3,5,7,12,14,16-hexaene].
| Compound Name | (2'R,10'S,11'S)-spiro[fluorene-9,9'-pentacyclo[9.7.0.02,10.03,8.012,17]octadeca-3,5,7,12,14,16-hexaene] |
|---|---|
| PubChem CID | 159928803 |
| Molecular Formula | C30H22 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | (2'R,10'S,11'S)-spiro[fluorene-9,9'-pentacyclo[9.7.0.02,10.03,8.012,17]octadeca-3,5,7,12,14,16-hexaene] |
| SMILES | c1ccc2c(c1)CC1[C@H]3c4ccccc4C4(c5ccccc5-c5ccccc54)[C@H]3[C@@H]21 |
| InChI | InChI=1S/C30H22/c1-2-10-19-18(9-1)17-23-27(19)29-28(23)22-13-5-8-16-26(22)30(29)24-14-6-3-11-20(24)21-12-4-7-15-25(21)30/h1-16,23,27-29H,17H2/t23?,27-,28+,29-/m0/s1 |
| InChIKey | CXUVJIRANJNFRA-VYJMLLJBSA-N |
| XLogP | 6.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'cycloheptane_2', 'substructure': 'N/A'} |
|---|