C13H14 — CID 11171225
(2S,3S,4R,7R)-7-methyltetracyclo[6.4.0.02,4.03,7]dodeca-1(12),8,10-triene (PubChem CID 11171225) has the molecular formula C13H14 and a molecular weight of 170.26 g/mol. Its IUPAC name is (2S,3S,4R,7R)-7-methyltetracyclo[6.4.0.02,4.03,7]dodeca-1(12),8,10-triene.
| Compound Name | (2S,3S,4R,7R)-7-methyltetracyclo[6.4.0.02,4.03,7]dodeca-1(12),8,10-triene |
|---|---|
| PubChem CID | 11171225 |
| Molecular Formula | C13H14 |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | (2S,3S,4R,7R)-7-methyltetracyclo[6.4.0.02,4.03,7]dodeca-1(12),8,10-triene |
| SMILES | C[C@]12CC[C@H]3[C@H](c4ccccc41)[C@H]32 |
| InChI | InChI=1S/C13H14/c1-13-7-6-9-11(12(9)13)8-4-2-3-5-10(8)13/h2-5,9,11-12H,6-7H2,1H3/t9-,11-,12-,13-/m0/s1 |
| InChIKey | QPXIMLXGKPIFOC-BQUFFADESA-N |
| XLogP | 3.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |