C16H27NO3 — CID 159929898
4-cyclohexylbutyl N-[(1R,2S)-2-methyl-4-oxocyclobutyl]carbamate (PubChem CID 159929898) has the molecular formula C16H27NO3 and a molecular weight of 281.40 g/mol. Its IUPAC name is 4-cyclohexylbutyl N-[(1R,2S)-2-methyl-4-oxocyclobutyl]carbamate.
| Compound Name | 4-cyclohexylbutyl N-[(1R,2S)-2-methyl-4-oxocyclobutyl]carbamate |
|---|---|
| PubChem CID | 159929898 |
| Molecular Formula | C16H27NO3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | 4-cyclohexylbutyl N-[(1R,2S)-2-methyl-4-oxocyclobutyl]carbamate |
| SMILES | C[C@H]1CC(=O)[C@@H]1NC(=O)OCCCCC1CCCCC1 |
| InChI | InChI=1S/C16H27NO3/c1-12-11-14(18)15(12)17-16(19)20-10-6-5-9-13-7-3-2-4-8-13/h12-13,15H,2-11H2,1H3,(H,17,19)/t12-,15+/m0/s1 |
| InChIKey | QNWSPZLFKYFAQW-SWLSCSKDSA-N |
| XLogP | 3.44 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|