C23H22N2O5S — CID 159938128
[2-[3-(3-methylsulfanyl-2,5-dioxopyrrolidin-1-yl)propanoylamino]-9H-fluoren-9-yl]methyl formate (PubChem CID 159938128) has the molecular formula C23H22N2O5S and a molecular weight of 438.51 g/mol. Its IUPAC name is [2-[3-(3-methylsulfanyl-2,5-dioxopyrrolidin-1-yl)propanoylamino]-9H-fluoren-9-yl]methyl formate.
| Compound Name | [2-[3-(3-methylsulfanyl-2,5-dioxopyrrolidin-1-yl)propanoylamino]-9H-fluoren-9-yl]methyl formate |
|---|---|
| PubChem CID | 159938128 |
| Molecular Formula | C23H22N2O5S |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | [2-[3-(3-methylsulfanyl-2,5-dioxopyrrolidin-1-yl)propanoylamino]-9H-fluoren-9-yl]methyl formate |
| SMILES | CSC1CC(=O)N(CCC(=O)Nc2ccc3c(c2)C(COC=O)c2ccccc2-3)C1=O |
| InChI | InChI=1S/C23H22N2O5S/c1-31-20-11-22(28)25(23(20)29)9-8-21(27)24-14-6-7-17-15-4-2-3-5-16(15)19(12-30-13-26)18(17)10-14/h2-7,10,13,19-20H,8-9,11-12H2,1H3,(H,24,27) |
| InChIKey | BOMAWAPNMPKOQH-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|