C34H44N4O7S — CID 118375032
[2-[3-(3-methylsulfanyl-2,5-dioxopyrrolidin-1-yl)propanoylamino]-9H-fluoren-9-yl]methyl N-[6-(ethylamino)-9-hydroxy-7-oxononyl]carbamate (PubChem CID 118375032) has the molecular formula C34H44N4O7S and a molecular weight of 652.81 g/mol. Its IUPAC name is [2-[3-(3-methylsulfanyl-2,5-dioxopyrrolidin-1-yl)propanoylamino]-9H-fluoren-9-yl]methyl N-[6-(ethylamino)-9-hydroxy-7-oxononyl]carbamate.
| Compound Name | [2-[3-(3-methylsulfanyl-2,5-dioxopyrrolidin-1-yl)propanoylamino]-9H-fluoren-9-yl]methyl N-[6-(ethylamino)-9-hydroxy-7-oxononyl]carbamate |
|---|---|
| PubChem CID | 118375032 |
| Molecular Formula | C34H44N4O7S |
| Molecular Weight | 652.81 g/mol |
| Exact Mass | 652.29 |
| IUPAC Name | [2-[3-(3-methylsulfanyl-2,5-dioxopyrrolidin-1-yl)propanoylamino]-9H-fluoren-9-yl]methyl N-[6-(ethylamino)-9-hydroxy-7-oxononyl]carbamate |
| SMILES | CCNC(CCCCCNC(=O)OCC1c2ccccc2-c2ccc(NC(=O)CCN3C(=O)CC(SC)C3=O)cc21)C(=O)CCO |
| InChI | InChI=1S/C34H44N4O7S/c1-3-35-28(29(40)15-18-39)11-5-4-8-16-36-34(44)45-21-27-24-10-7-6-9-23(24)25-13-12-22(19-26(25)27)37-31(41)14-17-38-32(42)20-30(46-2)33(38)43/h6-7,9-10,12-13,19,27-28,30,35,39H,3-5,8,11,14-18,20-21H2,1-2H3,(H,36,44)(H,37,41) |
| InChIKey | STRQIRQGNJMFRI-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 154.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.81 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|