C28H32N3O8S2+ — CID 59324396
5-[1-[3-[[9-(acetyloxymethyl)-5-sulfo-9H-fluoren-2-yl]amino]-3-oxopropyl]-2,5-dioxopyrrolidin-3-yl]sulfanylpentan-2-ylideneazanium (PubChem CID 59324396) has the molecular formula C28H32N3O8S2+ and a molecular weight of 602.71 g/mol. Its IUPAC name is 5-[1-[3-[[9-(acetyloxymethyl)-5-sulfo-9H-fluoren-2-yl]amino]-3-oxopropyl]-2,5-dioxopyrrolidin-3-yl]sulfanylpentan-2-ylideneazanium.
| Compound Name | 5-[1-[3-[[9-(acetyloxymethyl)-5-sulfo-9H-fluoren-2-yl]amino]-3-oxopropyl]-2,5-dioxopyrrolidin-3-yl]sulfanylpentan-2-ylideneazanium |
|---|---|
| PubChem CID | 59324396 |
| Molecular Formula | C28H32N3O8S2+ |
| Molecular Weight | 602.71 g/mol |
| Exact Mass | 602.16 |
| IUPAC Name | 5-[1-[3-[[9-(acetyloxymethyl)-5-sulfo-9H-fluoren-2-yl]amino]-3-oxopropyl]-2,5-dioxopyrrolidin-3-yl]sulfanylpentan-2-ylideneazanium |
| SMILES | CC(=[NH2+])CCCSC1CC(=O)N(CCC(=O)Nc2ccc3c(c2)C(COC(C)=O)c2cccc(S(=O)(=O)O)c2-3)C1=O |
| InChI | InChI=1S/C28H31N3O8S2/c1-16(29)5-4-12-40-23-14-26(34)31(28(23)35)11-10-25(33)30-18-8-9-20-21(13-18)22(15-39-17(2)32)19-6-3-7-24(27(19)20)41(36,37)38/h3,6-9,13,22-23,29H,4-5,10-12,14-15H2,1-2H3,(H,30,33)(H,36,37,38)/p+1 |
| InChIKey | LKZXHWSLOQDNBO-UHFFFAOYSA-O |
| XLogP | 1.80 |
| TPSA | 172.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.71 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|