C28H32N3O8S2+ — CID 59324403
5-[1-[3-[[9-(acetyloxymethyl)-7-(trioxidanylsulfanyl)-9H-fluoren-2-yl]amino]-3-oxopropyl]-2,5-dioxopyrrolidin-3-yl]sulfanylpentan-2-ylideneazanium (PubChem CID 59324403) has the molecular formula C28H32N3O8S2+ and a molecular weight of 602.71 g/mol. Its IUPAC name is 5-[1-[3-[[9-(acetyloxymethyl)-7-(trioxidanylsulfanyl)-9H-fluoren-2-yl]amino]-3-oxopropyl]-2,5-dioxopyrrolidin-3-yl]sulfanylpentan-2-ylideneazanium.
| Compound Name | 5-[1-[3-[[9-(acetyloxymethyl)-7-(trioxidanylsulfanyl)-9H-fluoren-2-yl]amino]-3-oxopropyl]-2,5-dioxopyrrolidin-3-yl]sulfanylpentan-2-ylideneazanium |
|---|---|
| PubChem CID | 59324403 |
| Molecular Formula | C28H32N3O8S2+ |
| Molecular Weight | 602.71 g/mol |
| Exact Mass | 602.16 |
| IUPAC Name | 5-[1-[3-[[9-(acetyloxymethyl)-7-(trioxidanylsulfanyl)-9H-fluoren-2-yl]amino]-3-oxopropyl]-2,5-dioxopyrrolidin-3-yl]sulfanylpentan-2-ylideneazanium |
| SMILES | CC(=[NH2+])CCCSC1CC(=O)N(CCC(=O)Nc2ccc3c(c2)C(COC(C)=O)c2cc(SOOO)ccc2-3)C1=O |
| InChI | InChI=1S/C28H31N3O8S2/c1-16(29)4-3-11-40-25-14-27(34)31(28(25)35)10-9-26(33)30-18-5-7-20-21-8-6-19(41-39-38-36)13-23(21)24(22(20)12-18)15-37-17(2)32/h5-8,12-13,24-25,29,36H,3-4,9-11,14-15H2,1-2H3,(H,30,33)/p+1 |
| InChIKey | DYPLTROHOJRIGN-UHFFFAOYSA-O |
| XLogP | 2.98 |
| TPSA | 157.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.71 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|