C19H16BrFO4S — CID 159939947
[(2R,3S,4S)-3-benzoyloxy-5-bromo-4-fluorothiolan-2-yl] 2-methylbenzoate (PubChem CID 159939947) has the molecular formula C19H16BrFO4S and a molecular weight of 439.30 g/mol. Its IUPAC name is [(2R,3S,4S)-3-benzoyloxy-5-bromo-4-fluorothiolan-2-yl] 2-methylbenzoate.
| Compound Name | [(2R,3S,4S)-3-benzoyloxy-5-bromo-4-fluorothiolan-2-yl] 2-methylbenzoate |
|---|---|
| PubChem CID | 159939947 |
| Molecular Formula | C19H16BrFO4S |
| Molecular Weight | 439.30 g/mol |
| Exact Mass | 437.99 |
| IUPAC Name | [(2R,3S,4S)-3-benzoyloxy-5-bromo-4-fluorothiolan-2-yl] 2-methylbenzoate |
| SMILES | Cc1ccccc1C(=O)O[C@@H]1SC(Br)[C@@H](F)[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H16BrFO4S/c1-11-7-5-6-10-13(11)18(23)25-19-15(14(21)16(20)26-19)24-17(22)12-8-3-2-4-9-12/h2-10,14-16,19H,1H3/t14-,15-,16?,19+/m0/s1 |
| InChIKey | DHHYPCXEZGPUIC-CJEYDRFVSA-N |
| XLogP | 4.51 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.30 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|