C44H41BN6O9 — CID 159944576
CID 159944576 (PubChem CID 159944576) has the molecular formula C44H41BN6O9 and a molecular weight of 808.66 g/mol.
| Compound Name | CID 159944576 |
|---|---|
| PubChem CID | 159944576 |
| Molecular Formula | C44H41BN6O9 |
| Molecular Weight | 808.66 g/mol |
| Exact Mass | 808.30 |
| IUPAC Name | — |
| SMILES | COc1ccc(Cn2ccc(C#N)cc2=O)cc1-c1cccc([N+](=O)[O-])c1.COc1ccc(Cn2ccc(CN)cc2=O)cc1-c1cccc([N+](=O)[O-])c1.[B]C1CCCO1 |
| InChI | InChI=1S/C20H19N3O4.C20H15N3O4.C4H7BO/c2*1-27-19-6-5-15(13-22-8-7-14(12-21)10-20(22)24)9-18(19)16-3-2-4-17(11-16)23(25)26;5-4-2-1-3-6-4/h2-11H,12-13,21H2,1H3;2-11H,13H2,1H3;4H,1-3H2 |
| InChIKey | MVGZAOWIKGEJKO-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 207.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.66 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|