About CID 159944576
CID 159944576 (PubChem CID 159944576) has the molecular formula C44H41BN6O9
and a molecular weight of 808.66 g/mol.
Molecular Properties
| Compound Name | CID 159944576 |
| PubChem CID | 159944576 |
| Molecular Formula | C44H41BN6O9 |
| Molecular Weight | 808.66 g/mol |
| Exact Mass | 808.30 |
| IUPAC Name | — |
| SMILES | COc1ccc(Cn2ccc(C#N)cc2=O)cc1-c1cccc([N+](=O)[O-])c1.COc1ccc(Cn2ccc(CN)cc2=O)cc1-c1cccc([N+](=O)[O-])c1.[B]C1CCCO1 |
| InChI | InChI=1S/C20H19N3O4.C20H15N3O4.C4H7BO/c2*1-27-19-6-5-15(13-22-8-7-14(12-21)10-20(22)24)9-18(19)16-3-2-4-17(11-16)23(25)26;5-4-2-1-3-6-4/h2-11H,12-13,21H2,1H3;2-11H,13H2,1H3;4H,1-3H2 |
| InChIKey | MVGZAOWIKGEJKO-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 207.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 60 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 808.66 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 159944576 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 159944576?
The IUPAC name of CID 159944576 (CID 159944576) is not available.
What is the SMILES notation for CID 159944576?
The canonical SMILES for CID 159944576 is COc1ccc(Cn2ccc(C#N)cc2=O)cc1-c1cccc([N+](=O)[O-])c1.COc1ccc(Cn2ccc(CN)cc2=O)cc1-c1cccc([N+](=O)[O-])c1.[B]C1CCCO1.
What is the InChIKey of CID 159944576?
The InChIKey is MVGZAOWIKGEJKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19N3O4.C20H15N3O4.C4H7BO/c2*1-27-19-6-5-15(13-22-8-7-14(12-21)10-20(22)24)9-18(19)16-3-2-4-17(11-16)23(25)26;5-4-2-1-3-6-4/h2-11H,12-13,21H2,1H3;2-11H,13H2,1H3;4H,1-3H2.
What are the key properties of CID 159944576?
CID 159944576 has a molecular weight of 808.66 g/mol, XLogP of 6.58, 11 rotatable bonds, 1 hydrogen bond donors, and 13 hydrogen bond acceptors.
Where does this data come from?
All data for CID 159944576 is sourced from PubChem (CID 159944576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).