C17H21N3O2 — CID 159946386
1-(4-methoxyphenyl)-3-(3,4,5,6-tetramethyl-2-pyridinyl)urea (PubChem CID 159946386) has the molecular formula C17H21N3O2 and a molecular weight of 299.37 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-3-(3,4,5,6-tetramethyl-2-pyridinyl)urea.
| Compound Name | 1-(4-methoxyphenyl)-3-(3,4,5,6-tetramethyl-2-pyridinyl)urea |
|---|---|
| PubChem CID | 159946386 |
| Molecular Formula | C17H21N3O2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | 1-(4-methoxyphenyl)-3-(3,4,5,6-tetramethyl-2-pyridinyl)urea |
| SMILES | COc1ccc(NC(=O)Nc2nc(C)c(C)c(C)c2C)cc1 |
| InChI | InChI=1S/C17H21N3O2/c1-10-11(2)13(4)18-16(12(10)3)20-17(21)19-14-6-8-15(22-5)9-7-14/h6-9H,1-5H3,(H2,18,19,20,21) |
| InChIKey | XQFWZEVJERBEBY-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |