C24H30N4O4S — CID 159949617
N'-ethyl-N-methyl-N-[5-[methyl-(N-methylsulfonyl-C-phenylcarbonimidoyl)amino]-2,4-dioxopentyl]benzenecarboximidamide (PubChem CID 159949617) has the molecular formula C24H30N4O4S and a molecular weight of 470.60 g/mol. Its IUPAC name is N'-ethyl-N-methyl-N-[5-[methyl-(N-methylsulfonyl-C-phenylcarbonimidoyl)amino]-2,4-dioxopentyl]benzenecarboximidamide.
| Compound Name | N'-ethyl-N-methyl-N-[5-[methyl-(N-methylsulfonyl-C-phenylcarbonimidoyl)amino]-2,4-dioxopentyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 159949617 |
| Molecular Formula | C24H30N4O4S |
| Molecular Weight | 470.60 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | N'-ethyl-N-methyl-N-[5-[methyl-(N-methylsulfonyl-C-phenylcarbonimidoyl)amino]-2,4-dioxopentyl]benzenecarboximidamide |
| SMILES | CC/N=C(\c1ccccc1)N(C)CC(=O)CC(=O)CN(C)C(=NS(C)(=O)=O)c1ccccc1 |
| InChI | InChI=1S/C24H30N4O4S/c1-5-25-23(19-12-8-6-9-13-19)27(2)17-21(29)16-22(30)18-28(3)24(26-33(4,31)32)20-14-10-7-11-15-20/h6-15H,5,16-18H2,1-4H3/b25-23+,26-24? |
| InChIKey | OBYAOGPUWOWZAD-QIDVXGNCSA-N |
| XLogP | 2.25 |
| TPSA | 99.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.60 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|