C23H45ISi4 — CID 159958330
[(Z)-1-iodo-2-methyl-4-trimethylsilylbut-1-en-3-ynyl]-trimethylsilane;trimethyl-[(E)-3-methyl-4-trimethylsilylpent-3-en-1-ynyl]silane (PubChem CID 159958330) has the molecular formula C23H45ISi4 and a molecular weight of 560.86 g/mol. Its IUPAC name is [(Z)-1-iodo-2-methyl-4-trimethylsilylbut-1-en-3-ynyl]-trimethylsilane;trimethyl-[(E)-3-methyl-4-trimethylsilylpent-3-en-1-ynyl]silane.
| Compound Name | [(Z)-1-iodo-2-methyl-4-trimethylsilylbut-1-en-3-ynyl]-trimethylsilane;trimethyl-[(E)-3-methyl-4-trimethylsilylpent-3-en-1-ynyl]silane |
|---|---|
| PubChem CID | 159958330 |
| Molecular Formula | C23H45ISi4 |
| Molecular Weight | 560.86 g/mol |
| Exact Mass | 560.16 |
| IUPAC Name | [(Z)-1-iodo-2-methyl-4-trimethylsilylbut-1-en-3-ynyl]-trimethylsilane;trimethyl-[(E)-3-methyl-4-trimethylsilylpent-3-en-1-ynyl]silane |
| SMILES | C/C(C#C[Si](C)(C)C)=C(/C)[Si](C)(C)C.C/C(C#C[Si](C)(C)C)=C(/I)[Si](C)(C)C |
| InChI | InChI=1S/C12H24Si2.C11H21ISi2/c1-11(9-10-13(3,4)5)12(2)14(6,7)8;1-10(8-9-13(2,3)4)11(12)14(5,6)7/h1-8H3;1-7H3/b12-11+;11-10+ |
| InChIKey | OCZOYPUFKWWEOZ-CXJFYUDPSA-N |
| XLogP | 8.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.86 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|