C25H34N4O3 — CID 15996017
N,N-bis(2-methylpropyl)-2-[(4-morpholin-4-ylphenyl)iminomethyl]-4-nitroaniline (PubChem CID 15996017) has the molecular formula C25H34N4O3 and a molecular weight of 438.57 g/mol. Its IUPAC name is N,N-bis(2-methylpropyl)-2-[(4-morpholin-4-ylphenyl)iminomethyl]-4-nitroaniline.
| Compound Name | N,N-bis(2-methylpropyl)-2-[(4-morpholin-4-ylphenyl)iminomethyl]-4-nitroaniline |
|---|---|
| PubChem CID | 15996017 |
| Molecular Formula | C25H34N4O3 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | N,N-bis(2-methylpropyl)-2-[(4-morpholin-4-ylphenyl)iminomethyl]-4-nitroaniline |
| SMILES | CC(C)CN(CC(C)C)c1ccc([N+](=O)[O-])cc1/C=N/c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C25H34N4O3/c1-19(2)17-28(18-20(3)4)25-10-9-24(29(30)31)15-21(25)16-26-22-5-7-23(8-6-22)27-11-13-32-14-12-27/h5-10,15-16,19-20H,11-14,17-18H2,1-4H3/b26-16+ |
| InChIKey | MHTNWCADCODRQN-WGOQTCKBSA-N |
| XLogP | 5.30 |
| TPSA | 71.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|