C20H20Cl2N2O4Sn — CID 159960393
6-amino-3-methyl-2,3-dihydroinden-1-one;dichlorotin;3-methyl-6-nitro-2,3-dihydroinden-1-one (PubChem CID 159960393) has the molecular formula C20H20Cl2N2O4Sn and a molecular weight of 542.01 g/mol. Its IUPAC name is 6-amino-3-methyl-2,3-dihydroinden-1-one;dichlorotin;3-methyl-6-nitro-2,3-dihydroinden-1-one.
| Compound Name | 6-amino-3-methyl-2,3-dihydroinden-1-one;dichlorotin;3-methyl-6-nitro-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 159960393 |
| Molecular Formula | C20H20Cl2N2O4Sn |
| Molecular Weight | 542.01 g/mol |
| Exact Mass | 541.98 |
| IUPAC Name | 6-amino-3-methyl-2,3-dihydroinden-1-one;dichlorotin;3-methyl-6-nitro-2,3-dihydroinden-1-one |
| SMILES | CC1CC(=O)c2cc(N)ccc21.CC1CC(=O)c2cc([N+](=O)[O-])ccc21.Cl[Sn]Cl |
| InChI | InChI=1S/C10H9NO3.C10H11NO.2ClH.Sn/c1-6-4-10(12)9-5-7(11(13)14)2-3-8(6)9;1-6-4-10(12)9-5-7(11)2-3-8(6)9;;;/h2-3,5-6H,4H2,1H3;2-3,5-6H,4,11H2,1H3;2*1H;/q;;;;+2/p-2 |
| InChIKey | ODGDJAUPDZNCCS-UHFFFAOYSA-L |
| XLogP | 5.24 |
| TPSA | 103.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.01 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|