C27H19NO3S5 — CID 159961102
(5Z)-5-[(4-phenylthiophen-2-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one;3-(4-phenylthiophen-2-yl)-2-sulfanylidenepropanoic acid (PubChem CID 159961102) has the molecular formula C27H19NO3S5 and a molecular weight of 565.79 g/mol. Its IUPAC name is (5Z)-5-[(4-phenylthiophen-2-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one;3-(4-phenylthiophen-2-yl)-2-sulfanylidenepropanoic acid.
| Compound Name | (5Z)-5-[(4-phenylthiophen-2-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one;3-(4-phenylthiophen-2-yl)-2-sulfanylidenepropanoic acid |
|---|---|
| PubChem CID | 159961102 |
| Molecular Formula | C27H19NO3S5 |
| Molecular Weight | 565.79 g/mol |
| Exact Mass | 565.00 |
| IUPAC Name | (5Z)-5-[(4-phenylthiophen-2-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one;3-(4-phenylthiophen-2-yl)-2-sulfanylidenepropanoic acid |
| SMILES | O=C(O)C(=S)Cc1cc(-c2ccccc2)cs1.O=C1NC(=S)S/C1=C\c1cc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C14H9NOS3.C13H10O2S2/c16-13-12(19-14(17)15-13)7-11-6-10(8-18-11)9-4-2-1-3-5-9;14-13(15)12(16)7-11-6-10(8-17-11)9-4-2-1-3-5-9/h1-8H,(H,15,16,17);1-6,8H,7H2,(H,14,15)/b12-7-; |
| InChIKey | ODINEWXXKMMNTB-OZLKFZLXSA-N |
| XLogP | 7.32 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.79 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|