C29H31NO13 — CID 159961831
2-[5-[2-[2-[(E)-3-(4-acetyloxy-3-methoxyphenyl)prop-2-enoyl]oxyethoxy]ethylcarbamoyl]-2,3-bis(carboxymethyl)phenyl]acetic acid (PubChem CID 159961831) has the molecular formula C29H31NO13 and a molecular weight of 601.56 g/mol. Its IUPAC name is 2-[5-[2-[2-[(E)-3-(4-acetyloxy-3-methoxyphenyl)prop-2-enoyl]oxyethoxy]ethylcarbamoyl]-2,3-bis(carboxymethyl)phenyl]acetic acid.
| Compound Name | 2-[5-[2-[2-[(E)-3-(4-acetyloxy-3-methoxyphenyl)prop-2-enoyl]oxyethoxy]ethylcarbamoyl]-2,3-bis(carboxymethyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 159961831 |
| Molecular Formula | C29H31NO13 |
| Molecular Weight | 601.56 g/mol |
| Exact Mass | 601.18 |
| IUPAC Name | 2-[5-[2-[2-[(E)-3-(4-acetyloxy-3-methoxyphenyl)prop-2-enoyl]oxyethoxy]ethylcarbamoyl]-2,3-bis(carboxymethyl)phenyl]acetic acid |
| SMILES | COc1cc(/C=C/C(=O)OCCOCCNC(=O)c2cc(CC(=O)O)c(CC(=O)O)c(CC(=O)O)c2)ccc1OC(C)=O |
| InChI | InChI=1S/C29H31NO13/c1-17(31)43-23-5-3-18(11-24(23)40-2)4-6-28(38)42-10-9-41-8-7-30-29(39)21-12-19(14-25(32)33)22(16-27(36)37)20(13-21)15-26(34)35/h3-6,11-13H,7-10,14-16H2,1-2H3,(H,30,39)(H,32,33)(H,34,35)(H,36,37)/b6-4+ |
| InChIKey | GSLILTPUILZMRW-GQCTYLIASA-N |
| XLogP | 1.50 |
| TPSA | 212.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.56 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|