C8H16F6N3O4S2- — CID 159965982
bis(trifluoromethylsulfonyl)azanide;3,3-dimethylbutane-1,1-diamine (PubChem CID 159965982) has the molecular formula C8H16F6N3O4S2- and a molecular weight of 396.36 g/mol. Its IUPAC name is bis(trifluoromethylsulfonyl)azanide;3,3-dimethylbutane-1,1-diamine.
| Compound Name | bis(trifluoromethylsulfonyl)azanide;3,3-dimethylbutane-1,1-diamine |
|---|---|
| PubChem CID | 159965982 |
| Molecular Formula | C8H16F6N3O4S2- |
| Molecular Weight | 396.36 g/mol |
| Exact Mass | 396.05 |
| IUPAC Name | bis(trifluoromethylsulfonyl)azanide;3,3-dimethylbutane-1,1-diamine |
| SMILES | CC(C)(C)CC(N)N.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H16N2.C2F6NO4S2/c1-6(2,3)4-5(7)8;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h5H,4,7-8H2,1-3H3;/q;-1 |
| InChIKey | ODXZMNGHWSCSCM-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 134.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.36 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|