C12H22F6N2O4S2 — CID 139189975
1,1,1-trifluoro-N-[(3R,4R)-2,2,5,5-tetramethyl-4-(trifluoromethylsulfonylamino)hexan-3-yl]methanesulfonamide (PubChem CID 139189975) has the molecular formula C12H22F6N2O4S2 and a molecular weight of 436.44 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-[(3R,4R)-2,2,5,5-tetramethyl-4-(trifluoromethylsulfonylamino)hexan-3-yl]methanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N-[(3R,4R)-2,2,5,5-tetramethyl-4-(trifluoromethylsulfonylamino)hexan-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 139189975 |
| Molecular Formula | C12H22F6N2O4S2 |
| Molecular Weight | 436.44 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | 1,1,1-trifluoro-N-[(3R,4R)-2,2,5,5-tetramethyl-4-(trifluoromethylsulfonylamino)hexan-3-yl]methanesulfonamide |
| SMILES | CC(C)(C)[C@@H](NS(=O)(=O)C(F)(F)F)[C@H](NS(=O)(=O)C(F)(F)F)C(C)(C)C |
| InChI | InChI=1S/C12H22F6N2O4S2/c1-9(2,3)7(19-25(21,22)11(13,14)15)8(10(4,5)6)20-26(23,24)12(16,17)18/h7-8,19-20H,1-6H3/t7-,8-/m0/s1 |
| InChIKey | XBLCQDILOPTSBT-YUMQZZPRSA-N |
| XLogP | 2.69 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.44 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |