C21H25N5O — CID 159978683
6-methyl-7-phenylmethoxy-4-N-[(3R)-piperidin-3-yl]quinazoline-2,4-diamine (PubChem CID 159978683) has the molecular formula C21H25N5O and a molecular weight of 363.47 g/mol. Its IUPAC name is 6-methyl-7-phenylmethoxy-4-N-[(3R)-piperidin-3-yl]quinazoline-2,4-diamine.
| Compound Name | 6-methyl-7-phenylmethoxy-4-N-[(3R)-piperidin-3-yl]quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 159978683 |
| Molecular Formula | C21H25N5O |
| Molecular Weight | 363.47 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | 6-methyl-7-phenylmethoxy-4-N-[(3R)-piperidin-3-yl]quinazoline-2,4-diamine |
| SMILES | Cc1cc2c(N[C@@H]3CCCNC3)nc(N)nc2cc1OCc1ccccc1 |
| InChI | InChI=1S/C21H25N5O/c1-14-10-17-18(11-19(14)27-13-15-6-3-2-4-7-15)25-21(22)26-20(17)24-16-8-5-9-23-12-16/h2-4,6-7,10-11,16,23H,5,8-9,12-13H2,1H3,(H3,22,24,25,26)/t16-/m1/s1 |
| InChIKey | RMXVQIAHQNMGSO-MRXNPFEDSA-N |
| XLogP | 3.26 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.47 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |