C17H30N2O3 — CID 159979599
N,N'-dimethyl-5-oxo-5-(2,2,3,4,4-pentamethyl-6-oxooxan-3-yl)pentanimidamide (PubChem CID 159979599) has the molecular formula C17H30N2O3 and a molecular weight of 310.44 g/mol. Its IUPAC name is N,N'-dimethyl-5-oxo-5-(2,2,3,4,4-pentamethyl-6-oxooxan-3-yl)pentanimidamide.
| Compound Name | N,N'-dimethyl-5-oxo-5-(2,2,3,4,4-pentamethyl-6-oxooxan-3-yl)pentanimidamide |
|---|---|
| PubChem CID | 159979599 |
| Molecular Formula | C17H30N2O3 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | N,N'-dimethyl-5-oxo-5-(2,2,3,4,4-pentamethyl-6-oxooxan-3-yl)pentanimidamide |
| SMILES | C/N=C(/CCCC(=O)C1(C)C(C)(C)CC(=O)OC1(C)C)NC |
| InChI | InChI=1S/C17H30N2O3/c1-15(2)11-14(21)22-16(3,4)17(15,5)12(20)9-8-10-13(18-6)19-7/h8-11H2,1-7H3,(H,18,19) |
| InChIKey | OFOWNOMPTJOAGC-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|