About bromomethane;propanoic acid
bromomethane;propanoic acid (PubChem CID 159987396) has the molecular formula C4H9BrO2
and a molecular weight of 169.02 g/mol. Its IUPAC name is bromomethane;propanoic acid.
Molecular Properties
| Compound Name | bromomethane;propanoic acid |
| PubChem CID | 159987396 |
| Molecular Formula | C4H9BrO2 |
| Molecular Weight | 169.02 g/mol |
| Exact Mass | 167.98 |
| IUPAC Name | bromomethane;propanoic acid |
| SMILES | CBr.CCC(=O)O |
| InChI | InChI=1S/C3H6O2.CH3Br/c1-2-3(4)5;1-2/h2H2,1H3,(H,4,5);1H3 |
| InChIKey | OGMXKHKUWROKRA-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.02 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze bromomethane;propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromomethane;propanoic acid?
The IUPAC name of bromomethane;propanoic acid (CID 159987396) is bromomethane;propanoic acid.
What is the SMILES notation for bromomethane;propanoic acid?
The canonical SMILES for bromomethane;propanoic acid is CBr.CCC(=O)O.
What is the InChIKey of bromomethane;propanoic acid?
The InChIKey is OGMXKHKUWROKRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O2.CH3Br/c1-2-3(4)5;1-2/h2H2,1H3,(H,4,5);1H3.
What are the key properties of bromomethane;propanoic acid?
bromomethane;propanoic acid has a molecular weight of 169.02 g/mol, XLogP of 1.49, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bromomethane;propanoic acid is sourced from PubChem (CID 159987396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).