C22H23N3 — CID 159994719
4-[(Z)-1,5-diphenylpent-1-enyl]pyridine-2,6-diamine (PubChem CID 159994719) has the molecular formula C22H23N3 and a molecular weight of 329.45 g/mol. Its IUPAC name is 4-[(Z)-1,5-diphenylpent-1-enyl]pyridine-2,6-diamine.
| Compound Name | 4-[(Z)-1,5-diphenylpent-1-enyl]pyridine-2,6-diamine |
|---|---|
| PubChem CID | 159994719 |
| Molecular Formula | C22H23N3 |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | 4-[(Z)-1,5-diphenylpent-1-enyl]pyridine-2,6-diamine |
| SMILES | Nc1cc(/C(=C\CCCc2ccccc2)c2ccccc2)cc(N)n1 |
| InChI | InChI=1S/C22H23N3/c23-21-15-19(16-22(24)25-21)20(18-12-5-2-6-13-18)14-8-7-11-17-9-3-1-4-10-17/h1-6,9-10,12-16H,7-8,11H2,(H4,23,24,25)/b20-14- |
| InChIKey | FHKIZMPVEQXUOD-ZHZULCJRSA-N |
| XLogP | 4.70 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|