About (4-iodophenyl)boronic acid;molecular hydrogen
(4-iodophenyl)boronic acid;molecular hydrogen (PubChem CID 160500107) has the molecular formula C6H10BIO2
and a molecular weight of 251.86 g/mol. Its IUPAC name is (4-iodophenyl)boronic acid;molecular hydrogen.
Molecular Properties
| Compound Name | (4-iodophenyl)boronic acid;molecular hydrogen |
| PubChem CID | 160500107 |
| Molecular Formula | C6H10BIO2 |
| Molecular Weight | 251.86 g/mol |
| Exact Mass | 251.98 |
| IUPAC Name | (4-iodophenyl)boronic acid;molecular hydrogen |
| SMILES | OB(O)c1ccc(I)cc1.[H][H].[H][H] |
| InChI | InChI=1S/C6H6BIO2.2H2/c8-6-3-1-5(2-4-6)7(9)10;;/h1-4,9-10H;2*1H |
| InChIKey | QRRDPPLVEXLSSY-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.86 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (4-iodophenyl)boronic acid;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-iodophenyl)boronic acid;molecular hydrogen?
The IUPAC name of (4-iodophenyl)boronic acid;molecular hydrogen (CID 160500107) is (4-iodophenyl)boronic acid;molecular hydrogen.
What is the SMILES notation for (4-iodophenyl)boronic acid;molecular hydrogen?
The canonical SMILES for (4-iodophenyl)boronic acid;molecular hydrogen is OB(O)c1ccc(I)cc1.[H][H].[H][H].
What is the InChIKey of (4-iodophenyl)boronic acid;molecular hydrogen?
The InChIKey is QRRDPPLVEXLSSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6BIO2.2H2/c8-6-3-1-5(2-4-6)7(9)10;;/h1-4,9-10H;2*1H.
What are the key properties of (4-iodophenyl)boronic acid;molecular hydrogen?
(4-iodophenyl)boronic acid;molecular hydrogen has a molecular weight of 251.86 g/mol, XLogP of 0.46, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-iodophenyl)boronic acid;molecular hydrogen is sourced from PubChem (CID 160500107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).