About acridine;(4-iodophenyl)boronic acid
acridine;(4-iodophenyl)boronic acid (PubChem CID 139147526) has the molecular formula C19H15BINO2
and a molecular weight of 427.05 g/mol. Its IUPAC name is acridine;(4-iodophenyl)boronic acid.
Molecular Properties
| Compound Name | acridine;(4-iodophenyl)boronic acid |
| PubChem CID | 139147526 |
| Molecular Formula | C19H15BINO2 |
| Molecular Weight | 427.05 g/mol |
| Exact Mass | 427.02 |
| IUPAC Name | acridine;(4-iodophenyl)boronic acid |
| SMILES | OB(O)c1ccc(I)cc1.c1ccc2nc3ccccc3cc2c1 |
| InChI | InChI=1S/C13H9N.C6H6BIO2/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12;8-6-3-1-5(2-4-6)7(9)10/h1-9H;1-4,9-10H |
| InChIKey | VLNDJLUTSUEESM-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.05 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze acridine;(4-iodophenyl)boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acridine;(4-iodophenyl)boronic acid?
The IUPAC name of acridine;(4-iodophenyl)boronic acid (CID 139147526) is acridine;(4-iodophenyl)boronic acid.
What is the SMILES notation for acridine;(4-iodophenyl)boronic acid?
The canonical SMILES for acridine;(4-iodophenyl)boronic acid is OB(O)c1ccc(I)cc1.c1ccc2nc3ccccc3cc2c1.
What is the InChIKey of acridine;(4-iodophenyl)boronic acid?
The InChIKey is VLNDJLUTSUEESM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9N.C6H6BIO2/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12;8-6-3-1-5(2-4-6)7(9)10/h1-9H;1-4,9-10H.
What are the key properties of acridine;(4-iodophenyl)boronic acid?
acridine;(4-iodophenyl)boronic acid has a molecular weight of 427.05 g/mol, XLogP of 3.36, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acridine;(4-iodophenyl)boronic acid is sourced from PubChem (CID 139147526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).