C27H35N5 — CID 160517169
4-N-[(2R)-3,3-dimethylbutan-2-yl]-2-N-(3,5-dimethylphenyl)-8-(1,2,3,6-tetrahydropyridin-4-yl)quinazoline-2,4-diamine (PubChem CID 160517169) has the molecular formula C27H35N5 and a molecular weight of 429.61 g/mol. Its IUPAC name is 4-N-[(2R)-3,3-dimethylbutan-2-yl]-2-N-(3,5-dimethylphenyl)-8-(1,2,3,6-tetrahydropyridin-4-yl)quinazoline-2,4-diamine.
| Compound Name | 4-N-[(2R)-3,3-dimethylbutan-2-yl]-2-N-(3,5-dimethylphenyl)-8-(1,2,3,6-tetrahydropyridin-4-yl)quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 160517169 |
| Molecular Formula | C27H35N5 |
| Molecular Weight | 429.61 g/mol |
| Exact Mass | 429.29 |
| IUPAC Name | 4-N-[(2R)-3,3-dimethylbutan-2-yl]-2-N-(3,5-dimethylphenyl)-8-(1,2,3,6-tetrahydropyridin-4-yl)quinazoline-2,4-diamine |
| SMILES | Cc1cc(C)cc(Nc2nc(N[C@H](C)C(C)(C)C)c3cccc(C4=CCNCC4)c3n2)c1 |
| InChI | InChI=1S/C27H35N5/c1-17-14-18(2)16-21(15-17)30-26-31-24-22(20-10-12-28-13-11-20)8-7-9-23(24)25(32-26)29-19(3)27(4,5)6/h7-10,14-16,19,28H,11-13H2,1-6H3,(H2,29,30,31,32)/t19-/m1/s1 |
| InChIKey | YIVUFENXTOHQBQ-LJQANCHMSA-N |
| XLogP | 6.21 |
| TPSA | 61.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.61 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |