About benzoic acid;iodic acid
benzoic acid;iodic acid (PubChem CID 160522551) has the molecular formula C7H7IO5
and a molecular weight of 298.03 g/mol. Its IUPAC name is benzoic acid;iodic acid.
Molecular Properties
| Compound Name | benzoic acid;iodic acid |
| PubChem CID | 160522551 |
| Molecular Formula | C7H7IO5 |
| Molecular Weight | 298.03 g/mol |
| Exact Mass | 297.93 |
| IUPAC Name | benzoic acid;iodic acid |
| SMILES | O=C(O)c1ccccc1.[O-][I+2]([O-])O |
| InChI | InChI=1S/C7H6O2.HIO3/c8-7(9)6-4-2-1-3-5-6;2-1(3)4/h1-5H,(H,8,9);2H |
| InChIKey | QULUKOGHBPGYGC-UHFFFAOYSA-N |
| XLogP | -4.55 |
| TPSA | 103.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.03 |
| LogP ≤ 5 | -4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze benzoic acid;iodic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzoic acid;iodic acid?
The IUPAC name of benzoic acid;iodic acid (CID 160522551) is benzoic acid;iodic acid.
What is the SMILES notation for benzoic acid;iodic acid?
The canonical SMILES for benzoic acid;iodic acid is O=C(O)c1ccccc1.[O-][I+2]([O-])O.
What is the InChIKey of benzoic acid;iodic acid?
The InChIKey is QULUKOGHBPGYGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O2.HIO3/c8-7(9)6-4-2-1-3-5-6;2-1(3)4/h1-5H,(H,8,9);2H.
What are the key properties of benzoic acid;iodic acid?
benzoic acid;iodic acid has a molecular weight of 298.03 g/mol, XLogP of -4.55, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzoic acid;iodic acid is sourced from PubChem (CID 160522551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).