About 2-hydroxy-1-[(2S)-piperidin-2-yl]ethanone;(2S)-piperidine-2-carboxylic acid;hydrochloride
2-hydroxy-1-[(2S)-piperidin-2-yl]ethanone;(2S)-piperidine-2-carboxylic acid;hydrochloride (PubChem CID 160529699) has the molecular formula C13H25ClN2O4
and a molecular weight of 308.81 g/mol. Its IUPAC name is 2-hydroxy-1-[(2S)-piperidin-2-yl]ethanone;(2S)-piperidine-2-carboxylic acid;hydrochloride.
Molecular Properties
| Compound Name | 2-hydroxy-1-[(2S)-piperidin-2-yl]ethanone;(2S)-piperidine-2-carboxylic acid;hydrochloride |
| PubChem CID | 160529699 |
| Molecular Formula | C13H25ClN2O4 |
| Molecular Weight | 308.81 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 2-hydroxy-1-[(2S)-piperidin-2-yl]ethanone;(2S)-piperidine-2-carboxylic acid;hydrochloride |
| SMILES | Cl.O=C(CO)[C@@H]1CCCCN1.O=C(O)[C@@H]1CCCCN1 |
| InChI | InChI=1S/C7H13NO2.C6H11NO2.ClH/c9-5-7(10)6-3-1-2-4-8-6;8-6(9)5-3-1-2-4-7-5;/h6,8-9H,1-5H2;5,7H,1-4H2,(H,8,9);1H/t6-;5-;/m00./s1 |
| InChIKey | KBAJACRFPHMGTH-MKZQLBLYSA-N |
| XLogP | 0.32 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.81 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-hydroxy-1-[(2S)-piperidin-2-yl]ethanone;(2S)-piperidine-2-carboxylic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-1-[(2S)-piperidin-2-yl]ethanone;(2S)-piperidine-2-carboxylic acid;hydrochloride?
The IUPAC name of 2-hydroxy-1-[(2S)-piperidin-2-yl]ethanone;(2S)-piperidine-2-carboxylic acid;hydrochloride (CID 160529699) is 2-hydroxy-1-[(2S)-piperidin-2-yl]ethanone;(2S)-piperidine-2-carboxylic acid;hydrochloride.
What is the SMILES notation for 2-hydroxy-1-[(2S)-piperidin-2-yl]ethanone;(2S)-piperidine-2-carboxylic acid;hydrochloride?
The canonical SMILES for 2-hydroxy-1-[(2S)-piperidin-2-yl]ethanone;(2S)-piperidine-2-carboxylic acid;hydrochloride is Cl.O=C(CO)[C@@H]1CCCCN1.O=C(O)[C@@H]1CCCCN1.
What is the InChIKey of 2-hydroxy-1-[(2S)-piperidin-2-yl]ethanone;(2S)-piperidine-2-carboxylic acid;hydrochloride?
The InChIKey is KBAJACRFPHMGTH-MKZQLBLYSA-N. The full InChI is InChI=1S/C7H13NO2.C6H11NO2.ClH/c9-5-7(10)6-3-1-2-4-8-6;8-6(9)5-3-1-2-4-7-5;/h6,8-9H,1-5H2;5,7H,1-4H2,(H,8,9);1H/t6-;5-;/m00./s1.
What are the key properties of 2-hydroxy-1-[(2S)-piperidin-2-yl]ethanone;(2S)-piperidine-2-carboxylic acid;hydrochloride?
2-hydroxy-1-[(2S)-piperidin-2-yl]ethanone;(2S)-piperidine-2-carboxylic acid;hydrochloride has a molecular weight of 308.81 g/mol, XLogP of 0.32, 3 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-1-[(2S)-piperidin-2-yl]ethanone;(2S)-piperidine-2-carboxylic acid;hydrochloride is sourced from PubChem (CID 160529699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).