C37H35F6N8OsP+2 — CID 160530129
benzhydryl-bis[5-(4-tert-butyl-2-pyridinyl)-3-(trifluoromethyl)-1,2,4-triazol-1-yl]phosphane;osmium(2+) (PubChem CID 160530129) has the molecular formula C37H35F6N8OsP+2 and a molecular weight of 926.93 g/mol. Its IUPAC name is benzhydryl-bis[5-(4-tert-butyl-2-pyridinyl)-3-(trifluoromethyl)-1,2,4-triazol-1-yl]phosphane;osmium(2+).
| Compound Name | benzhydryl-bis[5-(4-tert-butyl-2-pyridinyl)-3-(trifluoromethyl)-1,2,4-triazol-1-yl]phosphane;osmium(2+) |
|---|---|
| PubChem CID | 160530129 |
| Molecular Formula | C37H35F6N8OsP+2 |
| Molecular Weight | 926.93 g/mol |
| Exact Mass | 928.22 |
| IUPAC Name | benzhydryl-bis[5-(4-tert-butyl-2-pyridinyl)-3-(trifluoromethyl)-1,2,4-triazol-1-yl]phosphane;osmium(2+) |
| SMILES | CC(C)(C)c1ccnc(-c2nc(C(F)(F)F)nn2P(C(c2ccccc2)c2ccccc2)n2nc(C(F)(F)F)nc2-c2cc(C(C)(C)C)ccn2)c1.[Os+2] |
| InChI | InChI=1S/C37H35F6N8P.Os/c1-34(2,3)25-17-19-44-27(21-25)30-46-32(36(38,39)40)48-50(30)52(29(23-13-9-7-10-14-23)24-15-11-8-12-16-24)51-31(47-33(49-51)37(41,42)43)28-22-26(18-20-45-28)35(4,5)6;/h7-22,29H,1-6H3;/q;+2 |
| InChIKey | QVKVWMHPXFPWGT-UHFFFAOYSA-N |
| XLogP | 10.12 |
| TPSA | 87.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 926.93 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|