C24H17F6N8OsP+2 — CID 175714901
[2,3-bis[5-pyridin-2-yl-3-(trifluoromethyl)-1,2,4-triazol-1-yl]phenyl]-dimethylphosphane;osmium(2+) (PubChem CID 175714901) has the molecular formula C24H17F6N8OsP+2 and a molecular weight of 752.65 g/mol. Its IUPAC name is [2,3-bis[5-pyridin-2-yl-3-(trifluoromethyl)-1,2,4-triazol-1-yl]phenyl]-dimethylphosphane;osmium(2+).
| Compound Name | [2,3-bis[5-pyridin-2-yl-3-(trifluoromethyl)-1,2,4-triazol-1-yl]phenyl]-dimethylphosphane;osmium(2+) |
|---|---|
| PubChem CID | 175714901 |
| Molecular Formula | C24H17F6N8OsP+2 |
| Molecular Weight | 752.65 g/mol |
| Exact Mass | 754.08 |
| IUPAC Name | [2,3-bis[5-pyridin-2-yl-3-(trifluoromethyl)-1,2,4-triazol-1-yl]phenyl]-dimethylphosphane;osmium(2+) |
| SMILES | CP(C)c1cccc(-n2nc(C(F)(F)F)nc2-c2ccccn2)c1-n1nc(C(F)(F)F)nc1-c1ccccn1.[Os+2] |
| InChI | InChI=1S/C24H17F6N8P.Os/c1-39(2)17-11-7-10-16(37-19(14-8-3-5-12-31-14)33-21(35-37)23(25,26)27)18(17)38-20(15-9-4-6-13-32-15)34-22(36-38)24(28,29)30;/h3-13H,1-2H3;/q;+2 |
| InChIKey | HETVXNQNOVQOTF-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 87.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.65 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|