C19H38N2O4 — CID 160536656
tert-butyl 2-(2-hydroxyethyl)piperidine-1-carboxylate;2-piperidin-2-ylethanol (PubChem CID 160536656) has the molecular formula C19H38N2O4 and a molecular weight of 358.52 g/mol. Its IUPAC name is tert-butyl 2-(2-hydroxyethyl)piperidine-1-carboxylate;2-piperidin-2-ylethanol.
| Compound Name | tert-butyl 2-(2-hydroxyethyl)piperidine-1-carboxylate;2-piperidin-2-ylethanol |
|---|---|
| PubChem CID | 160536656 |
| Molecular Formula | C19H38N2O4 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.28 |
| IUPAC Name | tert-butyl 2-(2-hydroxyethyl)piperidine-1-carboxylate;2-piperidin-2-ylethanol |
| SMILES | CC(C)(C)OC(=O)N1CCCCC1CCO.OCCC1CCCCN1 |
| InChI | InChI=1S/C12H23NO3.C7H15NO/c1-12(2,3)16-11(15)13-8-5-4-6-10(13)7-9-14;9-6-4-7-3-1-2-5-8-7/h10,14H,4-9H2,1-3H3;7-9H,1-6H2 |
| InChIKey | QWFYQAJCBRLDIA-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |