C13H22F6O5 — CID 160547919
2-[[2-[2-(4,4-difluorohexoxy)-1,1-difluoroethoxy]-2,2-difluoroethoxy]methoxy]ethanol (PubChem CID 160547919) has the molecular formula C13H22F6O5 and a molecular weight of 372.30 g/mol. Its IUPAC name is 2-[[2-[2-(4,4-difluorohexoxy)-1,1-difluoroethoxy]-2,2-difluoroethoxy]methoxy]ethanol.
| Compound Name | 2-[[2-[2-(4,4-difluorohexoxy)-1,1-difluoroethoxy]-2,2-difluoroethoxy]methoxy]ethanol |
|---|---|
| PubChem CID | 160547919 |
| Molecular Formula | C13H22F6O5 |
| Molecular Weight | 372.30 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 2-[[2-[2-(4,4-difluorohexoxy)-1,1-difluoroethoxy]-2,2-difluoroethoxy]methoxy]ethanol |
| SMILES | CCC(F)(F)CCCOCC(F)(F)OC(F)(F)COCOCCO |
| InChI | InChI=1S/C13H22F6O5/c1-2-11(14,15)4-3-6-21-8-12(16,17)24-13(18,19)9-23-10-22-7-5-20/h20H,2-10H2,1H3 |
| InChIKey | GQHIITHUPUPYBG-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.30 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|