About molybdenum(4+);bis(oxo(disulfido)phosphanium)
molybdenum(4+);bis(oxo(disulfido)phosphanium) (PubChem CID 160557387) has the molecular formula MoO2P2S4+2
and a molecular weight of 318.15 g/mol. Its IUPAC name is molybdenum(4+);bis(oxo(disulfido)phosphanium).
Molecular Properties
| Compound Name | molybdenum(4+);bis(oxo(disulfido)phosphanium) |
| PubChem CID | 160557387 |
| Molecular Formula | MoO2P2S4+2 |
| Molecular Weight | 318.15 g/mol |
| Exact Mass | 319.73 |
| IUPAC Name | molybdenum(4+);bis(oxo(disulfido)phosphanium) |
| SMILES | O=[P+]([S-])[S-].O=[P+]([S-])[S-].[Mo+4] |
| InChI | InChI=1S/Mo.2HOPS2/c;2*1-2(3)4/h;2*(H,1,3,4)/q+4;;/p-2 |
| InChIKey | SVBQNQVDTJKEKT-UHFFFAOYSA-L |
| XLogP | 1.47 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.15 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze molybdenum(4+);bis(oxo(disulfido)phosphanium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of molybdenum(4+);bis(oxo(disulfido)phosphanium)?
The IUPAC name of molybdenum(4+);bis(oxo(disulfido)phosphanium) (CID 160557387) is molybdenum(4+);bis(oxo(disulfido)phosphanium).
What is the SMILES notation for molybdenum(4+);bis(oxo(disulfido)phosphanium)?
The canonical SMILES for molybdenum(4+);bis(oxo(disulfido)phosphanium) is O=[P+]([S-])[S-].O=[P+]([S-])[S-].[Mo+4].
What is the InChIKey of molybdenum(4+);bis(oxo(disulfido)phosphanium)?
The InChIKey is SVBQNQVDTJKEKT-UHFFFAOYSA-L. The full InChI is InChI=1S/Mo.2HOPS2/c;2*1-2(3)4/h;2*(H,1,3,4)/q+4;;/p-2.
What are the key properties of molybdenum(4+);bis(oxo(disulfido)phosphanium)?
molybdenum(4+);bis(oxo(disulfido)phosphanium) has a molecular weight of 318.15 g/mol, XLogP of 1.47, 0 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for molybdenum(4+);bis(oxo(disulfido)phosphanium) is sourced from PubChem (CID 160557387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).