C37H48Cl2N2O13 — CID 160559602
acetic acid;ethyl 2-(4-chloro-5-methoxy-2-methyl-1H-indol-3-yl)ethaneperoxoate;ethyl 2-(6-chloro-5-methoxy-2-methyl-1H-indol-3-yl)ethaneperoxoate;ethyl 4-oxopentanoate (PubChem CID 160559602) has the molecular formula C37H48Cl2N2O13 and a molecular weight of 799.70 g/mol. Its IUPAC name is acetic acid;ethyl 2-(4-chloro-5-methoxy-2-methyl-1H-indol-3-yl)ethaneperoxoate;ethyl 2-(6-chloro-5-methoxy-2-methyl-1H-indol-3-yl)ethaneperoxoate;ethyl 4-oxopentanoate.
| Compound Name | acetic acid;ethyl 2-(4-chloro-5-methoxy-2-methyl-1H-indol-3-yl)ethaneperoxoate;ethyl 2-(6-chloro-5-methoxy-2-methyl-1H-indol-3-yl)ethaneperoxoate;ethyl 4-oxopentanoate |
|---|---|
| PubChem CID | 160559602 |
| Molecular Formula | C37H48Cl2N2O13 |
| Molecular Weight | 799.70 g/mol |
| Exact Mass | 798.25 |
| IUPAC Name | acetic acid;ethyl 2-(4-chloro-5-methoxy-2-methyl-1H-indol-3-yl)ethaneperoxoate;ethyl 2-(6-chloro-5-methoxy-2-methyl-1H-indol-3-yl)ethaneperoxoate;ethyl 4-oxopentanoate |
| SMILES | CC(=O)O.CCOC(=O)CCC(C)=O.CCOOC(=O)Cc1c(C)[nH]c2cc(Cl)c(OC)cc12.CCOOC(=O)Cc1c(C)[nH]c2ccc(OC)c(Cl)c12 |
| InChI | InChI=1S/2C14H16ClNO4.C7H12O3.C2H4O2/c1-4-19-20-14(17)6-9-8(2)16-12-7-11(15)13(18-3)5-10(9)12;1-4-19-20-12(17)7-9-8(2)16-10-5-6-11(18-3)14(15)13(9)10;1-3-10-7(9)5-4-6(2)8;1-2(3)4/h5,7,16H,4,6H2,1-3H3;5-6,16H,4,7H2,1-3H3;3-5H2,1-2H3;1H3,(H,3,4) |
| InChIKey | WDADMHNIQBGSNF-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 201.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.70 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|