C29H69N9-4 — CID 160563062
carbanide;2-(3-methylbutan-2-ylideneamino)ethanimidamide;tris(N,N',2-trimethylpropanimidamide) (PubChem CID 160563062) has the molecular formula C29H69N9-4 and a molecular weight of 543.93 g/mol. Its IUPAC name is carbanide;2-(3-methylbutan-2-ylideneamino)ethanimidamide;tris(N,N',2-trimethylpropanimidamide).
| Compound Name | carbanide;2-(3-methylbutan-2-ylideneamino)ethanimidamide;tris(N,N',2-trimethylpropanimidamide) |
|---|---|
| PubChem CID | 160563062 |
| Molecular Formula | C29H69N9-4 |
| Molecular Weight | 543.93 g/mol |
| Exact Mass | 543.57 |
| IUPAC Name | carbanide;2-(3-methylbutan-2-ylideneamino)ethanimidamide;tris(N,N',2-trimethylpropanimidamide) |
| SMILES | C/N=C(/NC)C(C)C.C/N=C(/NC)C(C)C.C/N=C(/NC)C(C)C.[CH3-].[CH3-].[CH3-].[CH3-].[H]/N=C(\N)C/N=C(\C)C(C)C |
| InChI | InChI=1S/C7H15N3.3C6H14N2.4CH3/c1-5(2)6(3)10-4-7(8)9;3*1-5(2)6(7-3)8-4;;;;/h5H,4H2,1-3H3,(H3,8,9);3*5H,1-4H3,(H,7,8);4*1H3/q;;;;4*-1/b10-6+;;;;;;; |
| InChIKey | QZOMQTCMBUCHQU-OEWOPMNVSA-N |
| XLogP | 5.51 |
| TPSA | 135.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.93 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|