C13H21Cl2N7 — CID 172917804
2-[1-[4-[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]ethylideneamino]ethanimidamide;dihydrochloride (PubChem CID 172917804) has the molecular formula C13H21Cl2N7 and a molecular weight of 346.27 g/mol. Its IUPAC name is 2-[1-[4-[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]ethylideneamino]ethanimidamide;dihydrochloride.
| Compound Name | 2-[1-[4-[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]ethylideneamino]ethanimidamide;dihydrochloride |
|---|---|
| PubChem CID | 172917804 |
| Molecular Formula | C13H21Cl2N7 |
| Molecular Weight | 346.27 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | 2-[1-[4-[(E)-N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]ethylideneamino]ethanimidamide;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N)C/N=C(\C)c1ccc(/C(C)=N/N=C(N)N)cc1 |
| InChI | InChI=1S/C13H19N7.2ClH/c1-8(18-7-12(14)15)10-3-5-11(6-4-10)9(2)19-20-13(16)17;;/h3-6H,7H2,1-2H3,(H3,14,15)(H4,16,17,20);2*1H/b18-8+,19-9+;; |
| InChIKey | OJKFLENJAZIUCF-WIBAIKDQSA-N |
| XLogP | 1.27 |
| TPSA | 138.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.27 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|