C22H22ClO8P — CID 160570903
[2,3,6-triacetyloxy-4-chloro-5-[ethyl(phenyl)phosphanyl]phenyl] acetate (PubChem CID 160570903) has the molecular formula C22H22ClO8P and a molecular weight of 480.84 g/mol. Its IUPAC name is [2,3,6-triacetyloxy-4-chloro-5-[ethyl(phenyl)phosphanyl]phenyl] acetate.
| Compound Name | [2,3,6-triacetyloxy-4-chloro-5-[ethyl(phenyl)phosphanyl]phenyl] acetate |
|---|---|
| PubChem CID | 160570903 |
| Molecular Formula | C22H22ClO8P |
| Molecular Weight | 480.84 g/mol |
| Exact Mass | 480.07 |
| IUPAC Name | [2,3,6-triacetyloxy-4-chloro-5-[ethyl(phenyl)phosphanyl]phenyl] acetate |
| SMILES | CCP(c1ccccc1)c1c(Cl)c(OC(C)=O)c(OC(C)=O)c(OC(C)=O)c1OC(C)=O |
| InChI | InChI=1S/C22H22ClO8P/c1-6-32(16-10-8-7-9-11-16)22-17(23)18(28-12(2)24)19(29-13(3)25)20(30-14(4)26)21(22)31-15(5)27/h7-11H,6H2,1-5H3 |
| InChIKey | RJOZCUXZYCZSMA-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.84 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|