C28H23BF12O — CID 160573614
[3,5-bis(trifluoromethyl)phenyl]-[2-methyl-5-(trifluoromethyl)phenyl]-[3-methyl-5-(trifluoromethyl)phenyl]-(oxolan-1-ium-1-yl)boranuide (PubChem CID 160573614) has the molecular formula C28H23BF12O and a molecular weight of 614.28 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl]-[2-methyl-5-(trifluoromethyl)phenyl]-[3-methyl-5-(trifluoromethyl)phenyl]-(oxolan-1-ium-1-yl)boranuide.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl]-[2-methyl-5-(trifluoromethyl)phenyl]-[3-methyl-5-(trifluoromethyl)phenyl]-(oxolan-1-ium-1-yl)boranuide |
|---|---|
| PubChem CID | 160573614 |
| Molecular Formula | C28H23BF12O |
| Molecular Weight | 614.28 g/mol |
| Exact Mass | 614.17 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]-[2-methyl-5-(trifluoromethyl)phenyl]-[3-methyl-5-(trifluoromethyl)phenyl]-(oxolan-1-ium-1-yl)boranuide |
| SMILES | Cc1cc([B-](c2cc(C(F)(F)F)cc(C(F)(F)F)c2)(c2cc(C(F)(F)F)ccc2C)[O+]2CCCC2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C28H23BF12O/c1-16-9-19(26(33,34)35)12-22(10-16)29(42-7-3-4-8-42,24-15-18(25(30,31)32)6-5-17(24)2)23-13-20(27(36,37)38)11-21(14-23)28(39,40)41/h5-6,9-15H,3-4,7-8H2,1-2H3 |
| InChIKey | RAVZJEGVNOUKOU-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 2.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.28 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|