C25H38N4 — CID 160588408
4-tert-butyl-N,N-dimethylbenzenecarboximidamide;4-tert-butyl-N'-methylbenzenecarboximidamide (PubChem CID 160588408) has the molecular formula C25H38N4 and a molecular weight of 394.61 g/mol. Its IUPAC name is 4-tert-butyl-N,N-dimethylbenzenecarboximidamide;4-tert-butyl-N'-methylbenzenecarboximidamide.
| Compound Name | 4-tert-butyl-N,N-dimethylbenzenecarboximidamide;4-tert-butyl-N'-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 160588408 |
| Molecular Formula | C25H38N4 |
| Molecular Weight | 394.61 g/mol |
| Exact Mass | 394.31 |
| IUPAC Name | 4-tert-butyl-N,N-dimethylbenzenecarboximidamide;4-tert-butyl-N'-methylbenzenecarboximidamide |
| SMILES | C/N=C(\N)c1ccc(C(C)(C)C)cc1.[H]/N=C(/c1ccc(C(C)(C)C)cc1)N(C)C |
| InChI | InChI=1S/C13H20N2.C12H18N2/c1-13(2,3)11-8-6-10(7-9-11)12(14)15(4)5;1-12(2,3)10-7-5-9(6-8-10)11(13)14-4/h6-9,14H,1-5H3;5-8H,1-4H3,(H2,13,14)/b14-12-; |
| InChIKey | RCRRPWQHCRHUMR-CTMPBGLUSA-N |
| XLogP | 5.19 |
| TPSA | 65.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.61 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|