About 4-(N,N-dimethylcarbamimidoyl)benzamide
4-(N,N-dimethylcarbamimidoyl)benzamide (PubChem CID 69104062) has the molecular formula C10H13N3O
and a molecular weight of 191.23 g/mol. Its IUPAC name is 4-(N,N-dimethylcarbamimidoyl)benzamide.
Molecular Properties
| Compound Name | 4-(N,N-dimethylcarbamimidoyl)benzamide |
| PubChem CID | 69104062 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 4-(N,N-dimethylcarbamimidoyl)benzamide |
| SMILES | [H]/N=C(/c1ccc(C(N)=O)cc1)N(C)C |
| InChI | InChI=1S/C10H13N3O/c1-13(2)9(11)7-3-5-8(6-4-7)10(12)14/h3-6,11H,1-2H3,(H2,12,14)/b11-9- |
| InChIKey | BXDWIGQNAOFQGW-LUAWRHEFSA-N |
| XLogP | 0.67 |
| TPSA | 70.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(N,N-dimethylcarbamimidoyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(N,N-dimethylcarbamimidoyl)benzamide?
The IUPAC name of 4-(N,N-dimethylcarbamimidoyl)benzamide (CID 69104062) is 4-(N,N-dimethylcarbamimidoyl)benzamide.
What is the SMILES notation for 4-(N,N-dimethylcarbamimidoyl)benzamide?
The canonical SMILES for 4-(N,N-dimethylcarbamimidoyl)benzamide is [H]/N=C(/c1ccc(C(N)=O)cc1)N(C)C.
What is the InChIKey of 4-(N,N-dimethylcarbamimidoyl)benzamide?
The InChIKey is BXDWIGQNAOFQGW-LUAWRHEFSA-N. The full InChI is InChI=1S/C10H13N3O/c1-13(2)9(11)7-3-5-8(6-4-7)10(12)14/h3-6,11H,1-2H3,(H2,12,14)/b11-9-.
What are the key properties of 4-(N,N-dimethylcarbamimidoyl)benzamide?
4-(N,N-dimethylcarbamimidoyl)benzamide has a molecular weight of 191.23 g/mol, XLogP of 0.67, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(N,N-dimethylcarbamimidoyl)benzamide is sourced from PubChem (CID 69104062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).