C17H29ClN2 — CID 155895383
4-tert-butyl-N,N-di(propan-2-yl)benzenecarboximidamide;hydrochloride (PubChem CID 155895383) has the molecular formula C17H29ClN2 and a molecular weight of 296.89 g/mol. Its IUPAC name is 4-tert-butyl-N,N-di(propan-2-yl)benzenecarboximidamide;hydrochloride.
| Compound Name | 4-tert-butyl-N,N-di(propan-2-yl)benzenecarboximidamide;hydrochloride |
|---|---|
| PubChem CID | 155895383 |
| Molecular Formula | C17H29ClN2 |
| Molecular Weight | 296.89 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | 4-tert-butyl-N,N-di(propan-2-yl)benzenecarboximidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(/c1ccc(C(C)(C)C)cc1)N(C(C)C)C(C)C |
| InChI | InChI=1S/C17H28N2.ClH/c1-12(2)19(13(3)4)16(18)14-8-10-15(11-9-14)17(5,6)7;/h8-13,18H,1-7H3;1H/b18-16-; |
| InChIKey | UPKAZFCXHLBZPT-FTUZMNKQSA-N |
| XLogP | 4.85 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.89 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|