C13H18Cl2N2 — CID 67215168
2,6-dichloro-N,N-di(propan-2-yl)benzenecarboximidamide (PubChem CID 67215168) has the molecular formula C13H18Cl2N2 and a molecular weight of 273.21 g/mol. Its IUPAC name is 2,6-dichloro-N,N-di(propan-2-yl)benzenecarboximidamide.
| Compound Name | 2,6-dichloro-N,N-di(propan-2-yl)benzenecarboximidamide |
|---|---|
| PubChem CID | 67215168 |
| Molecular Formula | C13H18Cl2N2 |
| Molecular Weight | 273.21 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 2,6-dichloro-N,N-di(propan-2-yl)benzenecarboximidamide |
| SMILES | [H]/N=C(/c1c(Cl)cccc1Cl)N(C(C)C)C(C)C |
| InChI | InChI=1S/C13H18Cl2N2/c1-8(2)17(9(3)4)13(16)12-10(14)6-5-7-11(12)15/h5-9,16H,1-4H3/b16-13- |
| InChIKey | UHTSOONLQGXKKR-SSZFMOIBSA-N |
| XLogP | 4.44 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.21 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|