C15H24N2OV — CID 175895057
(2,6-dimethylphenyl) N,N-di(propan-2-yl)carbamimidate;vanadium (PubChem CID 175895057) has the molecular formula C15H24N2OV and a molecular weight of 299.31 g/mol. Its IUPAC name is (2,6-dimethylphenyl) N,N-di(propan-2-yl)carbamimidate;vanadium.
| Compound Name | (2,6-dimethylphenyl) N,N-di(propan-2-yl)carbamimidate;vanadium |
|---|---|
| PubChem CID | 175895057 |
| Molecular Formula | C15H24N2OV |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | (2,6-dimethylphenyl) N,N-di(propan-2-yl)carbamimidate;vanadium |
| SMILES | [H]/N=C(/Oc1c(C)cccc1C)N(C(C)C)C(C)C.[V] |
| InChI | InChI=1S/C15H24N2O.V/c1-10(2)17(11(3)4)15(16)18-14-12(5)8-7-9-13(14)6;/h7-11,16H,1-6H3;/b16-15+; |
| InChIKey | ZOAURMWHLVMWMV-GEEYTBSJSA-N |
| XLogP | 3.73 |
| TPSA | 36.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|