C24H28N2O — CID 160592204
5-benzhydryl-5-(piperazin-1-ylmethyl)cyclohexa-1,3-dien-1-ol (PubChem CID 160592204) has the molecular formula C24H28N2O and a molecular weight of 360.50 g/mol. Its IUPAC name is 5-benzhydryl-5-(piperazin-1-ylmethyl)cyclohexa-1,3-dien-1-ol.
| Compound Name | 5-benzhydryl-5-(piperazin-1-ylmethyl)cyclohexa-1,3-dien-1-ol |
|---|---|
| PubChem CID | 160592204 |
| Molecular Formula | C24H28N2O |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | 5-benzhydryl-5-(piperazin-1-ylmethyl)cyclohexa-1,3-dien-1-ol |
| SMILES | OC1=CC=CC(CN2CCNCC2)(C(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C24H28N2O/c27-22-12-7-13-24(18-22,19-26-16-14-25-15-17-26)23(20-8-3-1-4-9-20)21-10-5-2-6-11-21/h1-13,23,25,27H,14-19H2 |
| InChIKey | RDEGFWMTZFHNKQ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |