C25H46N4O4 — CID 160595968
2-ethyl-7,7,9,9-tetramethyl-1-oxa-4,8-diazaspiro[4.5]decan-3-one;2,7,7,9,9-pentamethyl-1-oxa-4,8-diazaspiro[4.5]decan-3-one (PubChem CID 160595968) has the molecular formula C25H46N4O4 and a molecular weight of 466.67 g/mol. Its IUPAC name is 2-ethyl-7,7,9,9-tetramethyl-1-oxa-4,8-diazaspiro[4.5]decan-3-one;2,7,7,9,9-pentamethyl-1-oxa-4,8-diazaspiro[4.5]decan-3-one.
| Compound Name | 2-ethyl-7,7,9,9-tetramethyl-1-oxa-4,8-diazaspiro[4.5]decan-3-one;2,7,7,9,9-pentamethyl-1-oxa-4,8-diazaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 160595968 |
| Molecular Formula | C25H46N4O4 |
| Molecular Weight | 466.67 g/mol |
| Exact Mass | 466.35 |
| IUPAC Name | 2-ethyl-7,7,9,9-tetramethyl-1-oxa-4,8-diazaspiro[4.5]decan-3-one;2,7,7,9,9-pentamethyl-1-oxa-4,8-diazaspiro[4.5]decan-3-one |
| SMILES | CC1OC2(CC(C)(C)NC(C)(C)C2)NC1=O.CCC1OC2(CC(C)(C)NC(C)(C)C2)NC1=O |
| InChI | InChI=1S/C13H24N2O2.C12H22N2O2/c1-6-9-10(16)14-13(17-9)7-11(2,3)15-12(4,5)8-13;1-8-9(15)13-12(16-8)6-10(2,3)14-11(4,5)7-12/h9,15H,6-8H2,1-5H3,(H,14,16);8,14H,6-7H2,1-5H3,(H,13,15) |
| InChIKey | RDQFPOXOCXRTTL-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 100.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.67 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |